About 2-methylbenzenecarbodithioic acid;2-methylpropanoic acid
2-methylbenzenecarbodithioic acid;2-methylpropanoic acid (PubChem CID 89396194) has the molecular formula C12H16O2S2
and a molecular weight of 256.39 g/mol. Its IUPAC name is 2-methylbenzenecarbodithioic acid;2-methylpropanoic acid.
Molecular Properties
| Compound Name | 2-methylbenzenecarbodithioic acid;2-methylpropanoic acid |
| PubChem CID | 89396194 |
| Molecular Formula | C12H16O2S2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | 2-methylbenzenecarbodithioic acid;2-methylpropanoic acid |
| SMILES | CC(C)C(=O)O.Cc1ccccc1C(=S)S |
| InChI | InChI=1S/C8H8S2.C4H8O2/c1-6-4-2-3-5-7(6)8(9)10;1-3(2)4(5)6/h2-5H,1H3,(H,9,10);3H,1-2H3,(H,5,6) |
| InChIKey | RATAUXJRALLMAG-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-methylbenzenecarbodithioic acid;2-methylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbenzenecarbodithioic acid;2-methylpropanoic acid?
The IUPAC name of 2-methylbenzenecarbodithioic acid;2-methylpropanoic acid (CID 89396194) is 2-methylbenzenecarbodithioic acid;2-methylpropanoic acid.
What is the SMILES notation for 2-methylbenzenecarbodithioic acid;2-methylpropanoic acid?
The canonical SMILES for 2-methylbenzenecarbodithioic acid;2-methylpropanoic acid is CC(C)C(=O)O.Cc1ccccc1C(=S)S.
What is the InChIKey of 2-methylbenzenecarbodithioic acid;2-methylpropanoic acid?
The InChIKey is RATAUXJRALLMAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8S2.C4H8O2/c1-6-4-2-3-5-7(6)8(9)10;1-3(2)4(5)6/h2-5H,1H3,(H,9,10);3H,1-2H3,(H,5,6).
What are the key properties of 2-methylbenzenecarbodithioic acid;2-methylpropanoic acid?
2-methylbenzenecarbodithioic acid;2-methylpropanoic acid has a molecular weight of 256.39 g/mol, XLogP of 3.33, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbenzenecarbodithioic acid;2-methylpropanoic acid is sourced from PubChem (CID 89396194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).