About 3-(diethylamino)-N,N-diethyl-3-phenyliminopropanethioamide
3-(diethylamino)-N,N-diethyl-3-phenyliminopropanethioamide (PubChem CID 10780934) has the molecular formula C17H27N3S
and a molecular weight of 305.49 g/mol. Its IUPAC name is 3-(diethylamino)-N,N-diethyl-3-phenyliminopropanethioamide.
Molecular Properties
| Compound Name | 3-(diethylamino)-N,N-diethyl-3-phenyliminopropanethioamide |
| PubChem CID | 10780934 |
| Molecular Formula | C17H27N3S |
| Molecular Weight | 305.49 g/mol |
| Exact Mass | 305.19 |
| IUPAC Name | 3-(diethylamino)-N,N-diethyl-3-phenyliminopropanethioamide |
| SMILES | CCN(CC)C(=S)C/C(=N\c1ccccc1)N(CC)CC |
| InChI | InChI=1S/C17H27N3S/c1-5-19(6-2)16(14-17(21)20(7-3)8-4)18-15-12-10-9-11-13-15/h9-13H,5-8,14H2,1-4H3/b18-16+ |
| InChIKey | OSWSZEDWRAHZTB-FBMGVBCBSA-N |
| XLogP | 4.12 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.49 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-(diethylamino)-N,N-diethyl-3-phenyliminopropanethioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(diethylamino)-N,N-diethyl-3-phenyliminopropanethioamide?
The IUPAC name of 3-(diethylamino)-N,N-diethyl-3-phenyliminopropanethioamide (CID 10780934) is 3-(diethylamino)-N,N-diethyl-3-phenyliminopropanethioamide.
What is the SMILES notation for 3-(diethylamino)-N,N-diethyl-3-phenyliminopropanethioamide?
The canonical SMILES for 3-(diethylamino)-N,N-diethyl-3-phenyliminopropanethioamide is CCN(CC)C(=S)C/C(=N\c1ccccc1)N(CC)CC.
What is the InChIKey of 3-(diethylamino)-N,N-diethyl-3-phenyliminopropanethioamide?
The InChIKey is OSWSZEDWRAHZTB-FBMGVBCBSA-N. The full InChI is InChI=1S/C17H27N3S/c1-5-19(6-2)16(14-17(21)20(7-3)8-4)18-15-12-10-9-11-13-15/h9-13H,5-8,14H2,1-4H3/b18-16+.
What are the key properties of 3-(diethylamino)-N,N-diethyl-3-phenyliminopropanethioamide?
3-(diethylamino)-N,N-diethyl-3-phenyliminopropanethioamide has a molecular weight of 305.49 g/mol, XLogP of 4.12, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(diethylamino)-N,N-diethyl-3-phenyliminopropanethioamide is sourced from PubChem (CID 10780934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).