C14H18N4O — CID 116514654
3-amino-1-ethyl-1-(furan-2-ylmethyl)-2-phenylguanidine (PubChem CID 116514654) has the molecular formula C14H18N4O and a molecular weight of 258.33 g/mol. Its IUPAC name is 3-amino-1-ethyl-1-(furan-2-ylmethyl)-2-phenylguanidine.
| Compound Name | 3-amino-1-ethyl-1-(furan-2-ylmethyl)-2-phenylguanidine |
|---|---|
| PubChem CID | 116514654 |
| Molecular Formula | C14H18N4O |
| Molecular Weight | 258.33 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | 3-amino-1-ethyl-1-(furan-2-ylmethyl)-2-phenylguanidine |
| SMILES | CCN(Cc1ccco1)/C(=N/c1ccccc1)NN |
| InChI | InChI=1S/C14H18N4O/c1-2-18(11-13-9-6-10-19-13)14(17-15)16-12-7-4-3-5-8-12/h3-10H,2,11,15H2,1H3,(H,16,17) |
| InChIKey | YAAVXEXUFKQKPN-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 66.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.33 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|