C23H32N2O2S — CID 18477611
N'-(benzenesulfonyl)-N,N-di(pentan-2-yl)benzenecarboximidamide (PubChem CID 18477611) has the molecular formula C23H32N2O2S and a molecular weight of 400.59 g/mol. Its IUPAC name is N'-(benzenesulfonyl)-N,N-di(pentan-2-yl)benzenecarboximidamide.
| Compound Name | N'-(benzenesulfonyl)-N,N-di(pentan-2-yl)benzenecarboximidamide |
|---|---|
| PubChem CID | 18477611 |
| Molecular Formula | C23H32N2O2S |
| Molecular Weight | 400.59 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | N'-(benzenesulfonyl)-N,N-di(pentan-2-yl)benzenecarboximidamide |
| SMILES | CCCC(C)N(/C(=N/S(=O)(=O)c1ccccc1)c1ccccc1)C(C)CCC |
| InChI | InChI=1S/C23H32N2O2S/c1-5-13-19(3)25(20(4)14-6-2)23(21-15-9-7-10-16-21)24-28(26,27)22-17-11-8-12-18-22/h7-12,15-20H,5-6,13-14H2,1-4H3/b24-23+ |
| InChIKey | ZRSBPGBYVXNFMS-WCWDXBQESA-N |
| XLogP | 5.50 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.59 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|