C16H17NO3 — CID 692790
5-benzoyl-N,N-diethylfuran-2-carboxamide (PubChem CID 692790) has the molecular formula C16H17NO3 and a molecular weight of 271.32 g/mol. Its IUPAC name is 5-benzoyl-N,N-diethylfuran-2-carboxamide.
| Compound Name | 5-benzoyl-N,N-diethylfuran-2-carboxamide |
|---|---|
| PubChem CID | 692790 |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 5-benzoyl-N,N-diethylfuran-2-carboxamide |
| SMILES | CCN(CC)C(=O)c1ccc(C(=O)c2ccccc2)o1 |
| InChI | InChI=1S/C16H17NO3/c1-3-17(4-2)16(19)14-11-10-13(20-14)15(18)12-8-6-5-7-9-12/h5-11H,3-4H2,1-2H3 |
| InChIKey | KBGWMFPXVOOLSD-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |