C10H14BrNO2 — CID 134860219
5-(bromomethyl)-N,N-diethylfuran-2-carboxamide (PubChem CID 134860219) has the molecular formula C10H14BrNO2 and a molecular weight of 260.13 g/mol. Its IUPAC name is 5-(bromomethyl)-N,N-diethylfuran-2-carboxamide.
| Compound Name | 5-(bromomethyl)-N,N-diethylfuran-2-carboxamide |
|---|---|
| PubChem CID | 134860219 |
| Molecular Formula | C10H14BrNO2 |
| Molecular Weight | 260.13 g/mol |
| Exact Mass | 259.02 |
| IUPAC Name | 5-(bromomethyl)-N,N-diethylfuran-2-carboxamide |
| SMILES | CCN(CC)C(=O)c1ccc(CBr)o1 |
| InChI | InChI=1S/C10H14BrNO2/c1-3-12(4-2)10(13)9-6-5-8(7-11)14-9/h5-6H,3-4,7H2,1-2H3 |
| InChIKey | FCXGJRPYHWKZST-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.13 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|