C13H20ClNO3 — CID 114263891
N-[2-(2-chloroethoxy)ethyl]-N,5-diethylfuran-2-carboxamide (PubChem CID 114263891) has the molecular formula C13H20ClNO3 and a molecular weight of 273.76 g/mol. Its IUPAC name is N-[2-(2-chloroethoxy)ethyl]-N,5-diethylfuran-2-carboxamide.
| Compound Name | N-[2-(2-chloroethoxy)ethyl]-N,5-diethylfuran-2-carboxamide |
|---|---|
| PubChem CID | 114263891 |
| Molecular Formula | C13H20ClNO3 |
| Molecular Weight | 273.76 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | N-[2-(2-chloroethoxy)ethyl]-N,5-diethylfuran-2-carboxamide |
| SMILES | CCc1ccc(C(=O)N(CC)CCOCCCl)o1 |
| InChI | InChI=1S/C13H20ClNO3/c1-3-11-5-6-12(18-11)13(16)15(4-2)8-10-17-9-7-14/h5-6H,3-4,7-10H2,1-2H3 |
| InChIKey | RUHLDLBWPJBKQX-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.76 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|