C60H66BN3P — CID 177436668
CID 177436668 (PubChem CID 177436668) has the molecular formula C60H66BN3P and a molecular weight of 870.99 g/mol.
| Compound Name | CID 177436668 |
|---|---|
| PubChem CID | 177436668 |
| Molecular Formula | C60H66BN3P |
| Molecular Weight | 870.99 g/mol |
| Exact Mass | 870.51 |
| IUPAC Name | — |
| SMILES | Cc1cc(C)cc(-c2cccc(-c3cc(C)cc(C)c3)c2P2[C@@H](c3ccccc3N/C(=N/c3c(C(C)C)cccc3C(C)C)c3ccccc3)[B]N2c2c(C(C)C)cccc2C(C)C)c1 |
| InChI | InChI=1S/C60H66BN3P/c1-37(2)48-24-18-25-49(38(3)4)56(48)63-60(45-21-14-13-15-22-45)62-55-30-17-16-23-54(55)59-61-64(57-50(39(5)6)26-19-27-51(57)40(7)8)65(59)58-52(46-33-41(9)31-42(10)34-46)28-20-29-53(58)47-35-43(11)32-44(12)36-47/h13-40,59H,1-12H3,(H,62,63)/t59-,65?/m0/s1 |
| InChIKey | VXVMKAAAHCYRBD-CLSXVOHKSA-N |
| XLogP | 16.80 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 870.99 |
| LogP ≤ 5 | 16.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|