C15H19O2S- — CID 57373596
3-cyclopentyl-2-phenylsulfanylbutanoate (PubChem CID 57373596) has the molecular formula C15H19O2S- and a molecular weight of 263.38 g/mol. Its IUPAC name is 3-cyclopentyl-2-phenylsulfanylbutanoate.
| Compound Name | 3-cyclopentyl-2-phenylsulfanylbutanoate |
|---|---|
| PubChem CID | 57373596 |
| Molecular Formula | C15H19O2S- |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | 3-cyclopentyl-2-phenylsulfanylbutanoate |
| SMILES | CC(C1CCCC1)C(Sc1ccccc1)C(=O)[O-] |
| InChI | InChI=1S/C15H20O2S/c1-11(12-7-5-6-8-12)14(15(16)17)18-13-9-3-2-4-10-13/h2-4,9-12,14H,5-8H2,1H3,(H,16,17)/p-1 |
| InChIKey | VXTFJBSEOOVMSQ-UHFFFAOYSA-M |
| XLogP | 2.72 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |