C23H28OS3 — CID 100984296
S-[4,4-bis(phenylsulfanyl)butan-2-yl] cyclohexanecarbothioate (PubChem CID 100984296) has the molecular formula C23H28OS3 and a molecular weight of 416.68 g/mol. Its IUPAC name is S-[4,4-bis(phenylsulfanyl)butan-2-yl] cyclohexanecarbothioate.
| Compound Name | S-[4,4-bis(phenylsulfanyl)butan-2-yl] cyclohexanecarbothioate |
|---|---|
| PubChem CID | 100984296 |
| Molecular Formula | C23H28OS3 |
| Molecular Weight | 416.68 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | S-[4,4-bis(phenylsulfanyl)butan-2-yl] cyclohexanecarbothioate |
| SMILES | CC(CC(Sc1ccccc1)Sc1ccccc1)SC(=O)C1CCCCC1 |
| InChI | InChI=1S/C23H28OS3/c1-18(25-23(24)19-11-5-2-6-12-19)17-22(26-20-13-7-3-8-14-20)27-21-15-9-4-10-16-21/h3-4,7-10,13-16,18-19,22H,2,5-6,11-12,17H2,1H3 |
| InChIKey | YOVGCWSSNUIWNX-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.68 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|