C20H32N4OS — CID 111677056
N-[2-[[N'-methyl-N-(2-phenylsulfanylpropyl)carbamimidoyl]amino]ethyl]cyclohexanecarboxamide (PubChem CID 111677056) has the molecular formula C20H32N4OS and a molecular weight of 376.57 g/mol. Its IUPAC name is N-[2-[[N'-methyl-N-(2-phenylsulfanylpropyl)carbamimidoyl]amino]ethyl]cyclohexanecarboxamide.
| Compound Name | N-[2-[[N'-methyl-N-(2-phenylsulfanylpropyl)carbamimidoyl]amino]ethyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 111677056 |
| Molecular Formula | C20H32N4OS |
| Molecular Weight | 376.57 g/mol |
| Exact Mass | 376.23 |
| IUPAC Name | N-[2-[[N'-methyl-N-(2-phenylsulfanylpropyl)carbamimidoyl]amino]ethyl]cyclohexanecarboxamide |
| SMILES | C/N=C(/NCCNC(=O)C1CCCCC1)NCC(C)Sc1ccccc1 |
| InChI | InChI=1S/C20H32N4OS/c1-16(26-18-11-7-4-8-12-18)15-24-20(21-2)23-14-13-22-19(25)17-9-5-3-6-10-17/h4,7-8,11-12,16-17H,3,5-6,9-10,13-15H2,1-2H3,(H,22,25)(H2,21,23,24) |
| InChIKey | ZMTJBCHZAFLJIC-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.57 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|