C22H28N2O2 — CID 133120117
N-[(2S,4S,6R)-2-cyclohexyl-6-quinolin-3-yloxan-4-yl]acetamide (PubChem CID 133120117) has the molecular formula C22H28N2O2 and a molecular weight of 352.48 g/mol. Its IUPAC name is N-[(2S,4S,6R)-2-cyclohexyl-6-quinolin-3-yloxan-4-yl]acetamide.
| Compound Name | N-[(2S,4S,6R)-2-cyclohexyl-6-quinolin-3-yloxan-4-yl]acetamide |
|---|---|
| PubChem CID | 133120117 |
| Molecular Formula | C22H28N2O2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | N-[(2S,4S,6R)-2-cyclohexyl-6-quinolin-3-yloxan-4-yl]acetamide |
| SMILES | CC(=O)N[C@H]1C[C@@H](C2CCCCC2)O[C@@H](c2cnc3ccccc3c2)C1 |
| InChI | InChI=1S/C22H28N2O2/c1-15(25)24-19-12-21(16-7-3-2-4-8-16)26-22(13-19)18-11-17-9-5-6-10-20(17)23-14-18/h5-6,9-11,14,16,19,21-22H,2-4,7-8,12-13H2,1H3,(H,24,25)/t19-,21-,22+/m0/s1 |
| InChIKey | CYXYPMJOXNZFTN-ILWGZMRPSA-N |
| XLogP | 4.54 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |