C11H10N2O2 — CID 13494441
2-(1,3-dioxolan-4-yl)quinoxaline (PubChem CID 13494441) has the molecular formula C11H10N2O2 and a molecular weight of 202.21 g/mol. Its IUPAC name is 2-(1,3-dioxolan-4-yl)quinoxaline.
| Compound Name | 2-(1,3-dioxolan-4-yl)quinoxaline |
|---|---|
| PubChem CID | 13494441 |
| Molecular Formula | C11H10N2O2 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | 2-(1,3-dioxolan-4-yl)quinoxaline |
| SMILES | c1ccc2nc(C3COCO3)cnc2c1 |
| InChI | InChI=1S/C11H10N2O2/c1-2-4-9-8(3-1)12-5-10(13-9)11-6-14-7-15-11/h1-5,11H,6-7H2 |
| InChIKey | YUKMZEXVRIOYRC-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |