C17H19N5O — CID 97330544
(3R)-3-(3,5-dimethyl-1H-pyrazol-4-yl)-4-quinoxalin-2-ylmorpholine (PubChem CID 97330544) has the molecular formula C17H19N5O and a molecular weight of 309.37 g/mol. Its IUPAC name is (3R)-3-(3,5-dimethyl-1H-pyrazol-4-yl)-4-quinoxalin-2-ylmorpholine.
| Compound Name | (3R)-3-(3,5-dimethyl-1H-pyrazol-4-yl)-4-quinoxalin-2-ylmorpholine |
|---|---|
| PubChem CID | 97330544 |
| Molecular Formula | C17H19N5O |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | (3R)-3-(3,5-dimethyl-1H-pyrazol-4-yl)-4-quinoxalin-2-ylmorpholine |
| SMILES | Cc1n[nH]c(C)c1[C@@H]1COCCN1c1cnc2ccccc2n1 |
| InChI | InChI=1S/C17H19N5O/c1-11-17(12(2)21-20-11)15-10-23-8-7-22(15)16-9-18-13-5-3-4-6-14(13)19-16/h3-6,9,15H,7-8,10H2,1-2H3,(H,20,21)/t15-/m0/s1 |
| InChIKey | ALLVJXXODUQLNK-HNNXBMFYSA-N |
| XLogP | 2.55 |
| TPSA | 66.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |