About 4,6-dichloro-2-(1,3-dioxolan-4-yl)pyrimidine
4,6-dichloro-2-(1,3-dioxolan-4-yl)pyrimidine (PubChem CID 87631921) has the molecular formula C7H6Cl2N2O2
and a molecular weight of 221.04 g/mol. Its IUPAC name is 4,6-dichloro-2-(1,3-dioxolan-4-yl)pyrimidine.
Molecular Properties
| Compound Name | 4,6-dichloro-2-(1,3-dioxolan-4-yl)pyrimidine |
| PubChem CID | 87631921 |
| Molecular Formula | C7H6Cl2N2O2 |
| Molecular Weight | 221.04 g/mol |
| Exact Mass | 219.98 |
| IUPAC Name | 4,6-dichloro-2-(1,3-dioxolan-4-yl)pyrimidine |
| SMILES | Clc1cc(Cl)nc(C2COCO2)n1 |
| InChI | InChI=1S/C7H6Cl2N2O2/c8-5-1-6(9)11-7(10-5)4-2-12-3-13-4/h1,4H,2-3H2 |
| InChIKey | OGDRYVWAJJQWJX-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.04 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4,6-dichloro-2-(1,3-dioxolan-4-yl)pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-dichloro-2-(1,3-dioxolan-4-yl)pyrimidine?
The IUPAC name of 4,6-dichloro-2-(1,3-dioxolan-4-yl)pyrimidine (CID 87631921) is 4,6-dichloro-2-(1,3-dioxolan-4-yl)pyrimidine.
What is the SMILES notation for 4,6-dichloro-2-(1,3-dioxolan-4-yl)pyrimidine?
The canonical SMILES for 4,6-dichloro-2-(1,3-dioxolan-4-yl)pyrimidine is Clc1cc(Cl)nc(C2COCO2)n1.
What is the InChIKey of 4,6-dichloro-2-(1,3-dioxolan-4-yl)pyrimidine?
The InChIKey is OGDRYVWAJJQWJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6Cl2N2O2/c8-5-1-6(9)11-7(10-5)4-2-12-3-13-4/h1,4H,2-3H2.
What are the key properties of 4,6-dichloro-2-(1,3-dioxolan-4-yl)pyrimidine?
4,6-dichloro-2-(1,3-dioxolan-4-yl)pyrimidine has a molecular weight of 221.04 g/mol, XLogP of 1.83, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-dichloro-2-(1,3-dioxolan-4-yl)pyrimidine is sourced from PubChem (CID 87631921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).