C7H6Cl2N2O2 — CID 87631921
4,6-dichloro-2-(1,3-dioxolan-4-yl)pyrimidine (PubChem CID 87631921) has the molecular formula C7H6Cl2N2O2 and a molecular weight of 221.04 g/mol. Its IUPAC name is 4,6-dichloro-2-(1,3-dioxolan-4-yl)pyrimidine.
| Compound Name | 4,6-dichloro-2-(1,3-dioxolan-4-yl)pyrimidine |
|---|---|
| PubChem CID | 87631921 |
| Molecular Formula | C7H6Cl2N2O2 |
| Molecular Weight | 221.04 g/mol |
| Exact Mass | 219.98 |
| IUPAC Name | 4,6-dichloro-2-(1,3-dioxolan-4-yl)pyrimidine |
| SMILES | Clc1cc(Cl)nc(C2COCO2)n1 |
| InChI | InChI=1S/C7H6Cl2N2O2/c8-5-1-6(9)11-7(10-5)4-2-12-3-13-4/h1,4H,2-3H2 |
| InChIKey | OGDRYVWAJJQWJX-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.04 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |