C7H11N5O2 — CID 112681592
6-(1,4-dioxan-2-yl)-1,3,5-triazine-2,4-diamine (PubChem CID 112681592) has the molecular formula C7H11N5O2 and a molecular weight of 197.20 g/mol. Its IUPAC name is 6-(1,4-dioxan-2-yl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(1,4-dioxan-2-yl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 112681592 |
| Molecular Formula | C7H11N5O2 |
| Molecular Weight | 197.20 g/mol |
| Exact Mass | 197.09 |
| IUPAC Name | 6-(1,4-dioxan-2-yl)-1,3,5-triazine-2,4-diamine |
| SMILES | Nc1nc(N)nc(C2COCCO2)n1 |
| InChI | InChI=1S/C7H11N5O2/c8-6-10-5(11-7(9)12-6)4-3-13-1-2-14-4/h4H,1-3H2,(H4,8,9,10,11,12) |
| InChIKey | OBQRUTALARPZPZ-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 109.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.20 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |