C14H22N4O2 — CID 65356333
4-cycloheptyl-6-(1,4-dioxan-2-yl)-1,3,5-triazin-2-amine (PubChem CID 65356333) has the molecular formula C14H22N4O2 and a molecular weight of 278.36 g/mol. Its IUPAC name is 4-cycloheptyl-6-(1,4-dioxan-2-yl)-1,3,5-triazin-2-amine.
| Compound Name | 4-cycloheptyl-6-(1,4-dioxan-2-yl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 65356333 |
| Molecular Formula | C14H22N4O2 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | 4-cycloheptyl-6-(1,4-dioxan-2-yl)-1,3,5-triazin-2-amine |
| SMILES | Nc1nc(C2CCCCCC2)nc(C2COCCO2)n1 |
| InChI | InChI=1S/C14H22N4O2/c15-14-17-12(10-5-3-1-2-4-6-10)16-13(18-14)11-9-19-7-8-20-11/h10-11H,1-9H2,(H2,15,16,17,18) |
| InChIKey | MFEBEXAZFDEVCU-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 83.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |