C14H14BrN3O2 — CID 66293308
5-bromo-2-(1,4-dioxan-2-yl)-6-phenylpyrimidin-4-amine (PubChem CID 66293308) has the molecular formula C14H14BrN3O2 and a molecular weight of 336.19 g/mol. Its IUPAC name is 5-bromo-2-(1,4-dioxan-2-yl)-6-phenylpyrimidin-4-amine.
| Compound Name | 5-bromo-2-(1,4-dioxan-2-yl)-6-phenylpyrimidin-4-amine |
|---|---|
| PubChem CID | 66293308 |
| Molecular Formula | C14H14BrN3O2 |
| Molecular Weight | 336.19 g/mol |
| Exact Mass | 335.03 |
| IUPAC Name | 5-bromo-2-(1,4-dioxan-2-yl)-6-phenylpyrimidin-4-amine |
| SMILES | Nc1nc(C2COCCO2)nc(-c2ccccc2)c1Br |
| InChI | InChI=1S/C14H14BrN3O2/c15-11-12(9-4-2-1-3-5-9)17-14(18-13(11)16)10-8-19-6-7-20-10/h1-5,10H,6-8H2,(H2,16,17,18) |
| InChIKey | YXNBCNUBTKYJEP-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 70.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.19 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |