C11H11ClN2O2S — CID 65353789
4-chloro-2-(1,4-dioxan-2-yl)-6-methylthieno[2,3-d]pyrimidine (PubChem CID 65353789) has the molecular formula C11H11ClN2O2S and a molecular weight of 270.74 g/mol. Its IUPAC name is 4-chloro-2-(1,4-dioxan-2-yl)-6-methylthieno[2,3-d]pyrimidine.
| Compound Name | 4-chloro-2-(1,4-dioxan-2-yl)-6-methylthieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 65353789 |
| Molecular Formula | C11H11ClN2O2S |
| Molecular Weight | 270.74 g/mol |
| Exact Mass | 270.02 |
| IUPAC Name | 4-chloro-2-(1,4-dioxan-2-yl)-6-methylthieno[2,3-d]pyrimidine |
| SMILES | Cc1cc2c(Cl)nc(C3COCCO3)nc2s1 |
| InChI | InChI=1S/C11H11ClN2O2S/c1-6-4-7-9(12)13-10(14-11(7)17-6)8-5-15-2-3-16-8/h4,8H,2-3,5H2,1H3 |
| InChIKey | IMPOGKWYECUIFM-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.74 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |