C11H15ClN2O2 — CID 65352084
5-(1-chloroethyl)-2-(1,4-dioxan-2-yl)-4-methylpyrimidine (PubChem CID 65352084) has the molecular formula C11H15ClN2O2 and a molecular weight of 242.71 g/mol. Its IUPAC name is 5-(1-chloroethyl)-2-(1,4-dioxan-2-yl)-4-methylpyrimidine.
| Compound Name | 5-(1-chloroethyl)-2-(1,4-dioxan-2-yl)-4-methylpyrimidine |
|---|---|
| PubChem CID | 65352084 |
| Molecular Formula | C11H15ClN2O2 |
| Molecular Weight | 242.71 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | 5-(1-chloroethyl)-2-(1,4-dioxan-2-yl)-4-methylpyrimidine |
| SMILES | Cc1nc(C2COCCO2)ncc1C(C)Cl |
| InChI | InChI=1S/C11H15ClN2O2/c1-7(12)9-5-13-11(14-8(9)2)10-6-15-3-4-16-10/h5,7,10H,3-4,6H2,1-2H3 |
| InChIKey | QAKFTZSAQDEEKL-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.71 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|