C18H14NO2S- — CID 5079957
2-(4-ethylphenyl)sulfanylquinoline-4-carboxylate (PubChem CID 5079957) has the molecular formula C18H14NO2S- and a molecular weight of 308.38 g/mol. Its IUPAC name is 2-(4-ethylphenyl)sulfanylquinoline-4-carboxylate.
| Compound Name | 2-(4-ethylphenyl)sulfanylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 5079957 |
| Molecular Formula | C18H14NO2S- |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 2-(4-ethylphenyl)sulfanylquinoline-4-carboxylate |
| SMILES | CCc1ccc(Sc2cc(C(=O)[O-])c3ccccc3n2)cc1 |
| InChI | InChI=1S/C18H15NO2S/c1-2-12-7-9-13(10-8-12)22-17-11-15(18(20)21)14-5-3-4-6-16(14)19-17/h3-11H,2H2,1H3,(H,20,21)/p-1 |
| InChIKey | LZIGNWNAVPGLTG-UHFFFAOYSA-M |
| XLogP | 3.31 |
| TPSA | 53.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |