C14H12NO4S- — CID 5067222
2-(2-ethoxy-2-oxoethyl)sulfanylquinoline-4-carboxylate (PubChem CID 5067222) has the molecular formula C14H12NO4S- and a molecular weight of 290.32 g/mol. Its IUPAC name is 2-(2-ethoxy-2-oxoethyl)sulfanylquinoline-4-carboxylate.
| Compound Name | 2-(2-ethoxy-2-oxoethyl)sulfanylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 5067222 |
| Molecular Formula | C14H12NO4S- |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | 2-(2-ethoxy-2-oxoethyl)sulfanylquinoline-4-carboxylate |
| SMILES | CCOC(=O)CSc1cc(C(=O)[O-])c2ccccc2n1 |
| InChI | InChI=1S/C14H13NO4S/c1-2-19-13(16)8-20-12-7-10(14(17)18)9-5-3-4-6-11(9)15-12/h3-7H,2,8H2,1H3,(H,17,18)/p-1 |
| InChIKey | JLNYQPFEISRFRA-UHFFFAOYSA-M |
| XLogP | 1.25 |
| TPSA | 79.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |