C17H15N3O3S — CID 2998523
methyl 2-[4-(1-methylimidazole-2-carbonyl)quinolin-2-yl]sulfanylacetate (PubChem CID 2998523) has the molecular formula C17H15N3O3S and a molecular weight of 341.39 g/mol. Its IUPAC name is methyl 2-[4-(1-methylimidazole-2-carbonyl)quinolin-2-yl]sulfanylacetate.
| Compound Name | methyl 2-[4-(1-methylimidazole-2-carbonyl)quinolin-2-yl]sulfanylacetate |
|---|---|
| PubChem CID | 2998523 |
| Molecular Formula | C17H15N3O3S |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | methyl 2-[4-(1-methylimidazole-2-carbonyl)quinolin-2-yl]sulfanylacetate |
| SMILES | COC(=O)CSc1cc(C(=O)c2nccn2C)c2ccccc2n1 |
| InChI | InChI=1S/C17H15N3O3S/c1-20-8-7-18-17(20)16(22)12-9-14(24-10-15(21)23-2)19-13-6-4-3-5-11(12)13/h3-9H,10H2,1-2H3 |
| InChIKey | AJMDVHMSDKRGOO-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |