C25H21ClN2OS — CID 4249991
2-(2-chlorophenyl)sulfanyl-N-[2-(4-methylphenyl)ethyl]quinoline-4-carboxamide (PubChem CID 4249991) has the molecular formula C25H21ClN2OS and a molecular weight of 432.98 g/mol. Its IUPAC name is 2-(2-chlorophenyl)sulfanyl-N-[2-(4-methylphenyl)ethyl]quinoline-4-carboxamide.
| Compound Name | 2-(2-chlorophenyl)sulfanyl-N-[2-(4-methylphenyl)ethyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 4249991 |
| Molecular Formula | C25H21ClN2OS |
| Molecular Weight | 432.98 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | 2-(2-chlorophenyl)sulfanyl-N-[2-(4-methylphenyl)ethyl]quinoline-4-carboxamide |
| SMILES | Cc1ccc(CCNC(=O)c2cc(Sc3ccccc3Cl)nc3ccccc23)cc1 |
| InChI | InChI=1S/C25H21ClN2OS/c1-17-10-12-18(13-11-17)14-15-27-25(29)20-16-24(28-22-8-4-2-6-19(20)22)30-23-9-5-3-7-21(23)26/h2-13,16H,14-15H2,1H3,(H,27,29) |
| InChIKey | OQZHDJWMOFIQJZ-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.98 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |