C23H16Cl2N2OS — CID 4244425
N-[(2-chlorophenyl)methyl]-2-(2-chlorophenyl)sulfanylquinoline-4-carboxamide (PubChem CID 4244425) has the molecular formula C23H16Cl2N2OS and a molecular weight of 439.37 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-2-(2-chlorophenyl)sulfanylquinoline-4-carboxamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-2-(2-chlorophenyl)sulfanylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 4244425 |
| Molecular Formula | C23H16Cl2N2OS |
| Molecular Weight | 439.37 g/mol |
| Exact Mass | 438.04 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-2-(2-chlorophenyl)sulfanylquinoline-4-carboxamide |
| SMILES | O=C(NCc1ccccc1Cl)c1cc(Sc2ccccc2Cl)nc2ccccc12 |
| InChI | InChI=1S/C23H16Cl2N2OS/c24-18-9-3-1-7-15(18)14-26-23(28)17-13-22(27-20-11-5-2-8-16(17)20)29-21-12-6-4-10-19(21)25/h1-13H,14H2,(H,26,28) |
| InChIKey | ZVMFSMIIWZPLOS-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.37 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |