C23H24N2O — CID 4224556
(2,6-dimethylpiperidin-1-yl)-(2-phenylquinolin-4-yl)methanone (PubChem CID 4224556) has the molecular formula C23H24N2O and a molecular weight of 344.46 g/mol. Its IUPAC name is (2,6-dimethylpiperidin-1-yl)-(2-phenylquinolin-4-yl)methanone.
| Compound Name | (2,6-dimethylpiperidin-1-yl)-(2-phenylquinolin-4-yl)methanone |
|---|---|
| PubChem CID | 4224556 |
| Molecular Formula | C23H24N2O |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | (2,6-dimethylpiperidin-1-yl)-(2-phenylquinolin-4-yl)methanone |
| SMILES | CC1CCCC(C)N1C(=O)c1cc(-c2ccccc2)nc2ccccc12 |
| InChI | InChI=1S/C23H24N2O/c1-16-9-8-10-17(2)25(16)23(26)20-15-22(18-11-4-3-5-12-18)24-21-14-7-6-13-19(20)21/h3-7,11-17H,8-10H2,1-2H3 |
| InChIKey | AUHUUWJMHOMVJH-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |