C20H24FN3O2S — CID 11936385
1-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-3-[[5-(4-fluorophenyl)furan-2-carbonyl]amino]thiourea (PubChem CID 11936385) has the molecular formula C20H24FN3O2S and a molecular weight of 389.50 g/mol. Its IUPAC name is 1-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-3-[[5-(4-fluorophenyl)furan-2-carbonyl]amino]thiourea.
| Compound Name | 1-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-3-[[5-(4-fluorophenyl)furan-2-carbonyl]amino]thiourea |
|---|---|
| PubChem CID | 11936385 |
| Molecular Formula | C20H24FN3O2S |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | 1-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-3-[[5-(4-fluorophenyl)furan-2-carbonyl]amino]thiourea |
| SMILES | C[C@@H]1[C@H](C)CCC[C@@H]1NC(=S)NNC(=O)c1ccc(-c2ccc(F)cc2)o1 |
| InChI | InChI=1S/C20H24FN3O2S/c1-12-4-3-5-16(13(12)2)22-20(27)24-23-19(25)18-11-10-17(26-18)14-6-8-15(21)9-7-14/h6-13,16H,3-5H2,1-2H3,(H,23,25)(H2,22,24,27)/t12-,13-,16+/m1/s1 |
| InChIKey | NPACGSNLGBNFIT-IOASZLSFSA-N |
| XLogP | 4.02 |
| TPSA | 66.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|