C19H24N4O5S — CID 11937196
1-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-3-[[(E)-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enoyl]amino]thiourea (PubChem CID 11937196) has the molecular formula C19H24N4O5S and a molecular weight of 420.49 g/mol. Its IUPAC name is 1-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-3-[[(E)-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enoyl]amino]thiourea.
| Compound Name | 1-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-3-[[(E)-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enoyl]amino]thiourea |
|---|---|
| PubChem CID | 11937196 |
| Molecular Formula | C19H24N4O5S |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | 1-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-3-[[(E)-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enoyl]amino]thiourea |
| SMILES | C[C@@H]1[C@H](C)CCC[C@@H]1NC(=S)NNC(=O)/C=C/c1cc2c(cc1[N+](=O)[O-])OCO2 |
| InChI | InChI=1S/C19H24N4O5S/c1-11-4-3-5-14(12(11)2)20-19(29)22-21-18(24)7-6-13-8-16-17(28-10-27-16)9-15(13)23(25)26/h6-9,11-12,14H,3-5,10H2,1-2H3,(H,21,24)(H2,20,22,29)/b7-6+/t11-,12-,14+/m1/s1 |
| InChIKey | TUPCGXHLFKTDDV-FXQXOBSTSA-N |
| XLogP | 2.66 |
| TPSA | 114.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|