C20H18Cl2N4S — CID 87505496
1-[[2-(benzylamino)-3-pyridinyl]methyl]-3-(2,3-dichlorophenyl)thiourea (PubChem CID 87505496) has the molecular formula C20H18Cl2N4S and a molecular weight of 417.37 g/mol. Its IUPAC name is 1-[[2-(benzylamino)-3-pyridinyl]methyl]-3-(2,3-dichlorophenyl)thiourea.
| Compound Name | 1-[[2-(benzylamino)-3-pyridinyl]methyl]-3-(2,3-dichlorophenyl)thiourea |
|---|---|
| PubChem CID | 87505496 |
| Molecular Formula | C20H18Cl2N4S |
| Molecular Weight | 417.37 g/mol |
| Exact Mass | 416.06 |
| IUPAC Name | 1-[[2-(benzylamino)-3-pyridinyl]methyl]-3-(2,3-dichlorophenyl)thiourea |
| SMILES | S=C(NCc1cccnc1NCc1ccccc1)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C20H18Cl2N4S/c21-16-9-4-10-17(18(16)22)26-20(27)25-13-15-8-5-11-23-19(15)24-12-14-6-2-1-3-7-14/h1-11H,12-13H2,(H,23,24)(H2,25,26,27) |
| InChIKey | DUQYDZYJMZGLHL-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 48.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.37 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|