C18H14Cl2N4S — CID 86082273
1-(2,3-dichlorophenyl)-3-[(2-pyridin-3-yl-3-pyridinyl)methyl]thiourea (PubChem CID 86082273) has the molecular formula C18H14Cl2N4S and a molecular weight of 389.31 g/mol. Its IUPAC name is 1-(2,3-dichlorophenyl)-3-[(2-pyridin-3-yl-3-pyridinyl)methyl]thiourea.
| Compound Name | 1-(2,3-dichlorophenyl)-3-[(2-pyridin-3-yl-3-pyridinyl)methyl]thiourea |
|---|---|
| PubChem CID | 86082273 |
| Molecular Formula | C18H14Cl2N4S |
| Molecular Weight | 389.31 g/mol |
| Exact Mass | 388.03 |
| IUPAC Name | 1-(2,3-dichlorophenyl)-3-[(2-pyridin-3-yl-3-pyridinyl)methyl]thiourea |
| SMILES | S=C(NCc1cccnc1-c1cccnc1)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C18H14Cl2N4S/c19-14-6-1-7-15(16(14)20)24-18(25)23-11-13-5-3-9-22-17(13)12-4-2-8-21-10-12/h1-10H,11H2,(H2,23,24,25) |
| InChIKey | NHLIRWWAMQRJNO-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.31 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|