C25H19Cl2FN4OS — CID 87505512
1-[[2-(1-benzyl-2-oxo-4-pyridinyl)-3-pyridinyl]methyl]-3-(2,3-dichloro-4-fluorophenyl)thiourea (PubChem CID 87505512) has the molecular formula C25H19Cl2FN4OS and a molecular weight of 513.43 g/mol. Its IUPAC name is 1-[[2-(1-benzyl-2-oxo-4-pyridinyl)-3-pyridinyl]methyl]-3-(2,3-dichloro-4-fluorophenyl)thiourea.
| Compound Name | 1-[[2-(1-benzyl-2-oxo-4-pyridinyl)-3-pyridinyl]methyl]-3-(2,3-dichloro-4-fluorophenyl)thiourea |
|---|---|
| PubChem CID | 87505512 |
| Molecular Formula | C25H19Cl2FN4OS |
| Molecular Weight | 513.43 g/mol |
| Exact Mass | 512.06 |
| IUPAC Name | 1-[[2-(1-benzyl-2-oxo-4-pyridinyl)-3-pyridinyl]methyl]-3-(2,3-dichloro-4-fluorophenyl)thiourea |
| SMILES | O=c1cc(-c2ncccc2CNC(=S)Nc2ccc(F)c(Cl)c2Cl)ccn1Cc1ccccc1 |
| InChI | InChI=1S/C25H19Cl2FN4OS/c26-22-19(28)8-9-20(23(22)27)31-25(34)30-14-18-7-4-11-29-24(18)17-10-12-32(21(33)13-17)15-16-5-2-1-3-6-16/h1-13H,14-15H2,(H2,30,31,34) |
| InChIKey | KVRWWAPFJLPFPC-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.43 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|