C16H14Cl2F2N4S — CID 87506288
1-(2,3-dichlorophenyl)-3-[[2-(3,3-difluoroazetidin-1-yl)-3-pyridinyl]methyl]thiourea (PubChem CID 87506288) has the molecular formula C16H14Cl2F2N4S and a molecular weight of 403.29 g/mol. Its IUPAC name is 1-(2,3-dichlorophenyl)-3-[[2-(3,3-difluoroazetidin-1-yl)-3-pyridinyl]methyl]thiourea.
| Compound Name | 1-(2,3-dichlorophenyl)-3-[[2-(3,3-difluoroazetidin-1-yl)-3-pyridinyl]methyl]thiourea |
|---|---|
| PubChem CID | 87506288 |
| Molecular Formula | C16H14Cl2F2N4S |
| Molecular Weight | 403.29 g/mol |
| Exact Mass | 402.03 |
| IUPAC Name | 1-(2,3-dichlorophenyl)-3-[[2-(3,3-difluoroazetidin-1-yl)-3-pyridinyl]methyl]thiourea |
| SMILES | FC1(F)CN(c2ncccc2CNC(=S)Nc2cccc(Cl)c2Cl)C1 |
| InChI | InChI=1S/C16H14Cl2F2N4S/c17-11-4-1-5-12(13(11)18)23-15(25)22-7-10-3-2-6-21-14(10)24-8-16(19,20)9-24/h1-6H,7-9H2,(H2,22,23,25) |
| InChIKey | XWGRKPWHEYDSSR-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 40.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.29 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|