C17H17Cl2FN4S — CID 87505264
1-(2,3-dichlorophenyl)-3-[(5-fluoro-2-pyrrolidin-1-yl-3-pyridinyl)methyl]thiourea (PubChem CID 87505264) has the molecular formula C17H17Cl2FN4S and a molecular weight of 399.32 g/mol. Its IUPAC name is 1-(2,3-dichlorophenyl)-3-[(5-fluoro-2-pyrrolidin-1-yl-3-pyridinyl)methyl]thiourea.
| Compound Name | 1-(2,3-dichlorophenyl)-3-[(5-fluoro-2-pyrrolidin-1-yl-3-pyridinyl)methyl]thiourea |
|---|---|
| PubChem CID | 87505264 |
| Molecular Formula | C17H17Cl2FN4S |
| Molecular Weight | 399.32 g/mol |
| Exact Mass | 398.05 |
| IUPAC Name | 1-(2,3-dichlorophenyl)-3-[(5-fluoro-2-pyrrolidin-1-yl-3-pyridinyl)methyl]thiourea |
| SMILES | Fc1cnc(N2CCCC2)c(CNC(=S)Nc2cccc(Cl)c2Cl)c1 |
| InChI | InChI=1S/C17H17Cl2FN4S/c18-13-4-3-5-14(15(13)19)23-17(25)22-9-11-8-12(20)10-21-16(11)24-6-1-2-7-24/h3-5,8,10H,1-2,6-7,9H2,(H2,22,23,25) |
| InChIKey | ZLHWOZCXDZCUOC-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 40.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.32 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|