C14H12Cl2N2S2 — CID 14045065
1-benzyl-3-(4,5-dichloro-2-sulfanylphenyl)thiourea (PubChem CID 14045065) has the molecular formula C14H12Cl2N2S2 and a molecular weight of 343.30 g/mol. Its IUPAC name is 1-benzyl-3-(4,5-dichloro-2-sulfanylphenyl)thiourea.
| Compound Name | 1-benzyl-3-(4,5-dichloro-2-sulfanylphenyl)thiourea |
|---|---|
| PubChem CID | 14045065 |
| Molecular Formula | C14H12Cl2N2S2 |
| Molecular Weight | 343.30 g/mol |
| Exact Mass | 341.98 |
| IUPAC Name | 1-benzyl-3-(4,5-dichloro-2-sulfanylphenyl)thiourea |
| SMILES | S=C(NCc1ccccc1)Nc1cc(Cl)c(Cl)cc1S |
| InChI | InChI=1S/C14H12Cl2N2S2/c15-10-6-12(13(19)7-11(10)16)18-14(20)17-8-9-4-2-1-3-5-9/h1-7,19H,8H2,(H2,17,18,20) |
| InChIKey | BAQOXOIQVDNVHJ-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.30 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|