C16H15ClN2O3S — CID 91687091
4-(benzylcarbamothioylamino)-5-chloro-2-methoxybenzoic acid (PubChem CID 91687091) has the molecular formula C16H15ClN2O3S and a molecular weight of 350.83 g/mol. Its IUPAC name is 4-(benzylcarbamothioylamino)-5-chloro-2-methoxybenzoic acid.
| Compound Name | 4-(benzylcarbamothioylamino)-5-chloro-2-methoxybenzoic acid |
|---|---|
| PubChem CID | 91687091 |
| Molecular Formula | C16H15ClN2O3S |
| Molecular Weight | 350.83 g/mol |
| Exact Mass | 350.05 |
| IUPAC Name | 4-(benzylcarbamothioylamino)-5-chloro-2-methoxybenzoic acid |
| SMILES | COc1cc(NC(=S)NCc2ccccc2)c(Cl)cc1C(=O)O |
| InChI | InChI=1S/C16H15ClN2O3S/c1-22-14-8-13(12(17)7-11(14)15(20)21)19-16(23)18-9-10-5-3-2-4-6-10/h2-8H,9H2,1H3,(H,20,21)(H2,18,19,23) |
| InChIKey | LRDWCPGDYHTGLI-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.83 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|