C17H18ClN3O2S — CID 34948341
1-benzyl-3-[[2-(3-chloro-4-methoxyphenyl)acetyl]amino]thiourea (PubChem CID 34948341) has the molecular formula C17H18ClN3O2S and a molecular weight of 363.87 g/mol. Its IUPAC name is 1-benzyl-3-[[2-(3-chloro-4-methoxyphenyl)acetyl]amino]thiourea.
| Compound Name | 1-benzyl-3-[[2-(3-chloro-4-methoxyphenyl)acetyl]amino]thiourea |
|---|---|
| PubChem CID | 34948341 |
| Molecular Formula | C17H18ClN3O2S |
| Molecular Weight | 363.87 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | 1-benzyl-3-[[2-(3-chloro-4-methoxyphenyl)acetyl]amino]thiourea |
| SMILES | COc1ccc(CC(=O)NNC(=S)NCc2ccccc2)cc1Cl |
| InChI | InChI=1S/C17H18ClN3O2S/c1-23-15-8-7-13(9-14(15)18)10-16(22)20-21-17(24)19-11-12-5-3-2-4-6-12/h2-9H,10-11H2,1H3,(H,20,22)(H2,19,21,24) |
| InChIKey | RRRXXYVLKIOKSP-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.87 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|