C20H25N3O5S — CID 9086023
1-[(4-methoxyphenyl)methyl]-3-[[2-(2,3,4-trimethoxyphenyl)acetyl]amino]thiourea (PubChem CID 9086023) has the molecular formula C20H25N3O5S and a molecular weight of 419.50 g/mol. Its IUPAC name is 1-[(4-methoxyphenyl)methyl]-3-[[2-(2,3,4-trimethoxyphenyl)acetyl]amino]thiourea.
| Compound Name | 1-[(4-methoxyphenyl)methyl]-3-[[2-(2,3,4-trimethoxyphenyl)acetyl]amino]thiourea |
|---|---|
| PubChem CID | 9086023 |
| Molecular Formula | C20H25N3O5S |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | 1-[(4-methoxyphenyl)methyl]-3-[[2-(2,3,4-trimethoxyphenyl)acetyl]amino]thiourea |
| SMILES | COc1ccc(CNC(=S)NNC(=O)Cc2ccc(OC)c(OC)c2OC)cc1 |
| InChI | InChI=1S/C20H25N3O5S/c1-25-15-8-5-13(6-9-15)12-21-20(29)23-22-17(24)11-14-7-10-16(26-2)19(28-4)18(14)27-3/h5-10H,11-12H2,1-4H3,(H,22,24)(H2,21,23,29) |
| InChIKey | NXUCOTWFISQNQA-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 90.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|