C15H17N5O3S2 — CID 8565122
1-[(4-methoxyphenyl)methyl]-3-[[2-(4-oxo-2-sulfanylidene-1H-pyrimidin-6-yl)acetyl]amino]thiourea (PubChem CID 8565122) has the molecular formula C15H17N5O3S2 and a molecular weight of 379.47 g/mol. Its IUPAC name is 1-[(4-methoxyphenyl)methyl]-3-[[2-(4-oxo-2-sulfanylidene-1H-pyrimidin-6-yl)acetyl]amino]thiourea.
| Compound Name | 1-[(4-methoxyphenyl)methyl]-3-[[2-(4-oxo-2-sulfanylidene-1H-pyrimidin-6-yl)acetyl]amino]thiourea |
|---|---|
| PubChem CID | 8565122 |
| Molecular Formula | C15H17N5O3S2 |
| Molecular Weight | 379.47 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | 1-[(4-methoxyphenyl)methyl]-3-[[2-(4-oxo-2-sulfanylidene-1H-pyrimidin-6-yl)acetyl]amino]thiourea |
| SMILES | COc1ccc(CNC(=S)NNC(=O)Cc2cc(=O)[nH]c(=S)[nH]2)cc1 |
| InChI | InChI=1S/C15H17N5O3S2/c1-23-11-4-2-9(3-5-11)8-16-14(24)20-19-13(22)7-10-6-12(21)18-15(25)17-10/h2-6H,7-8H2,1H3,(H,19,22)(H2,16,20,24)(H2,17,18,21,25) |
| InChIKey | QUBXFBLCSUWHPX-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 111.04 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.47 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|