C23H22BrN3O3S — CID 1428090
N-[4-(benzylcarbamothioylamino)-2,5-dimethoxyphenyl]-4-bromobenzamide (PubChem CID 1428090) has the molecular formula C23H22BrN3O3S and a molecular weight of 500.42 g/mol. Its IUPAC name is N-[4-(benzylcarbamothioylamino)-2,5-dimethoxyphenyl]-4-bromobenzamide.
| Compound Name | N-[4-(benzylcarbamothioylamino)-2,5-dimethoxyphenyl]-4-bromobenzamide |
|---|---|
| PubChem CID | 1428090 |
| Molecular Formula | C23H22BrN3O3S |
| Molecular Weight | 500.42 g/mol |
| Exact Mass | 499.06 |
| IUPAC Name | N-[4-(benzylcarbamothioylamino)-2,5-dimethoxyphenyl]-4-bromobenzamide |
| SMILES | COc1cc(NC(=S)NCc2ccccc2)c(OC)cc1NC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C23H22BrN3O3S/c1-29-20-13-19(27-23(31)25-14-15-6-4-3-5-7-15)21(30-2)12-18(20)26-22(28)16-8-10-17(24)11-9-16/h3-13H,14H2,1-2H3,(H,26,28)(H2,25,27,31) |
| InChIKey | TXRRKAFOGINMOX-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.42 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|