C19H21N3O3S — CID 8660268
N-[2,5-dimethoxy-4-(prop-2-enylcarbamothioylamino)phenyl]benzamide (PubChem CID 8660268) has the molecular formula C19H21N3O3S and a molecular weight of 371.46 g/mol. Its IUPAC name is N-[2,5-dimethoxy-4-(prop-2-enylcarbamothioylamino)phenyl]benzamide.
| Compound Name | N-[2,5-dimethoxy-4-(prop-2-enylcarbamothioylamino)phenyl]benzamide |
|---|---|
| PubChem CID | 8660268 |
| Molecular Formula | C19H21N3O3S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | N-[2,5-dimethoxy-4-(prop-2-enylcarbamothioylamino)phenyl]benzamide |
| SMILES | C=CCNC(=S)Nc1cc(OC)c(NC(=O)c2ccccc2)cc1OC |
| InChI | InChI=1S/C19H21N3O3S/c1-4-10-20-19(26)22-15-12-16(24-2)14(11-17(15)25-3)21-18(23)13-8-6-5-7-9-13/h4-9,11-12H,1,10H2,2-3H3,(H,21,23)(H2,20,22,26) |
| InChIKey | PFNOWFHMDVVTSA-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|