C13H16N2O3S — CID 18822898
3,4-dimethoxy-N-(prop-2-enylcarbamothioyl)benzamide (PubChem CID 18822898) has the molecular formula C13H16N2O3S and a molecular weight of 280.35 g/mol. Its IUPAC name is 3,4-dimethoxy-N-(prop-2-enylcarbamothioyl)benzamide.
| Compound Name | 3,4-dimethoxy-N-(prop-2-enylcarbamothioyl)benzamide |
|---|---|
| PubChem CID | 18822898 |
| Molecular Formula | C13H16N2O3S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 3,4-dimethoxy-N-(prop-2-enylcarbamothioyl)benzamide |
| SMILES | C=CCNC(=S)NC(=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C13H16N2O3S/c1-4-7-14-13(19)15-12(16)9-5-6-10(17-2)11(8-9)18-3/h4-6,8H,1,7H2,2-3H3,(H2,14,15,16,19) |
| InChIKey | LJLUPEKCTMDWHL-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|