C27H29N3O5 — CID 3274754
N'-(4-benzamido-2,5-dimethoxyphenyl)-N-benzylpentanediamide (PubChem CID 3274754) has the molecular formula C27H29N3O5 and a molecular weight of 475.55 g/mol. Its IUPAC name is N'-(4-benzamido-2,5-dimethoxyphenyl)-N-benzylpentanediamide.
| Compound Name | N'-(4-benzamido-2,5-dimethoxyphenyl)-N-benzylpentanediamide |
|---|---|
| PubChem CID | 3274754 |
| Molecular Formula | C27H29N3O5 |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.21 |
| IUPAC Name | N'-(4-benzamido-2,5-dimethoxyphenyl)-N-benzylpentanediamide |
| SMILES | COc1cc(NC(=O)c2ccccc2)c(OC)cc1NC(=O)CCCC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C27H29N3O5/c1-34-23-17-22(30-27(33)20-12-7-4-8-13-20)24(35-2)16-21(23)29-26(32)15-9-14-25(31)28-18-19-10-5-3-6-11-19/h3-8,10-13,16-17H,9,14-15,18H2,1-2H3,(H,28,31)(H,29,32)(H,30,33) |
| InChIKey | CQICJPZJKULAEP-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |