C27H29N3O5 — CID 4203137
N-(4-benzamido-2,5-dimethoxyphenyl)-N'-(1-phenylethyl)butanediamide (PubChem CID 4203137) has the molecular formula C27H29N3O5 and a molecular weight of 475.55 g/mol. Its IUPAC name is N-(4-benzamido-2,5-dimethoxyphenyl)-N'-(1-phenylethyl)butanediamide.
| Compound Name | N-(4-benzamido-2,5-dimethoxyphenyl)-N'-(1-phenylethyl)butanediamide |
|---|---|
| PubChem CID | 4203137 |
| Molecular Formula | C27H29N3O5 |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.21 |
| IUPAC Name | N-(4-benzamido-2,5-dimethoxyphenyl)-N'-(1-phenylethyl)butanediamide |
| SMILES | COc1cc(NC(=O)c2ccccc2)c(OC)cc1NC(=O)CCC(=O)NC(C)c1ccccc1 |
| InChI | InChI=1S/C27H29N3O5/c1-18(19-10-6-4-7-11-19)28-25(31)14-15-26(32)29-21-16-24(35-3)22(17-23(21)34-2)30-27(33)20-12-8-5-9-13-20/h4-13,16-18H,14-15H2,1-3H3,(H,28,31)(H,29,32)(H,30,33) |
| InChIKey | YGAAPZBAIWKWTC-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |