C25H26N2O5 — CID 2604010
N-[2,5-dimethoxy-4-[3-(3-methylphenoxy)propanoylamino]phenyl]benzamide (PubChem CID 2604010) has the molecular formula C25H26N2O5 and a molecular weight of 434.49 g/mol. Its IUPAC name is N-[2,5-dimethoxy-4-[3-(3-methylphenoxy)propanoylamino]phenyl]benzamide.
| Compound Name | N-[2,5-dimethoxy-4-[3-(3-methylphenoxy)propanoylamino]phenyl]benzamide |
|---|---|
| PubChem CID | 2604010 |
| Molecular Formula | C25H26N2O5 |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | N-[2,5-dimethoxy-4-[3-(3-methylphenoxy)propanoylamino]phenyl]benzamide |
| SMILES | COc1cc(NC(=O)c2ccccc2)c(OC)cc1NC(=O)CCOc1cccc(C)c1 |
| InChI | InChI=1S/C25H26N2O5/c1-17-8-7-11-19(14-17)32-13-12-24(28)26-20-15-23(31-3)21(16-22(20)30-2)27-25(29)18-9-5-4-6-10-18/h4-11,14-16H,12-13H2,1-3H3,(H,26,28)(H,27,29) |
| InChIKey | OGTFHTZYSJUUKP-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |