C27H30N2O5 — CID 19191042
N-[4-[4-(2,3-dimethylphenoxy)butanoylamino]-2,5-dimethoxyphenyl]benzamide (PubChem CID 19191042) has the molecular formula C27H30N2O5 and a molecular weight of 462.55 g/mol. Its IUPAC name is N-[4-[4-(2,3-dimethylphenoxy)butanoylamino]-2,5-dimethoxyphenyl]benzamide.
| Compound Name | N-[4-[4-(2,3-dimethylphenoxy)butanoylamino]-2,5-dimethoxyphenyl]benzamide |
|---|---|
| PubChem CID | 19191042 |
| Molecular Formula | C27H30N2O5 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | N-[4-[4-(2,3-dimethylphenoxy)butanoylamino]-2,5-dimethoxyphenyl]benzamide |
| SMILES | COc1cc(NC(=O)c2ccccc2)c(OC)cc1NC(=O)CCCOc1cccc(C)c1C |
| InChI | InChI=1S/C27H30N2O5/c1-18-10-8-13-23(19(18)2)34-15-9-14-26(30)28-21-16-25(33-4)22(17-24(21)32-3)29-27(31)20-11-6-5-7-12-20/h5-8,10-13,16-17H,9,14-15H2,1-4H3,(H,28,30)(H,29,31) |
| InChIKey | XRIUALGSPVLXJL-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|