C26H29N3O3S — CID 1172457
N-[4-(benzylcarbamothioylamino)-2,5-diethoxyphenyl]-3-methylbenzamide (PubChem CID 1172457) has the molecular formula C26H29N3O3S and a molecular weight of 463.60 g/mol. Its IUPAC name is N-[4-(benzylcarbamothioylamino)-2,5-diethoxyphenyl]-3-methylbenzamide.
| Compound Name | N-[4-(benzylcarbamothioylamino)-2,5-diethoxyphenyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 1172457 |
| Molecular Formula | C26H29N3O3S |
| Molecular Weight | 463.60 g/mol |
| Exact Mass | 463.19 |
| IUPAC Name | N-[4-(benzylcarbamothioylamino)-2,5-diethoxyphenyl]-3-methylbenzamide |
| SMILES | CCOc1cc(NC(=S)NCc2ccccc2)c(OCC)cc1NC(=O)c1cccc(C)c1 |
| InChI | InChI=1S/C26H29N3O3S/c1-4-31-23-16-22(29-26(33)27-17-19-11-7-6-8-12-19)24(32-5-2)15-21(23)28-25(30)20-13-9-10-18(3)14-20/h6-16H,4-5,17H2,1-3H3,(H,28,30)(H2,27,29,33) |
| InChIKey | JPHWIFKTQUPUDO-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.60 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|