C22H28BrN3O3S — CID 1428250
4-bromo-N-[2,5-diethoxy-4-(2-methylpropylcarbamothioylamino)phenyl]benzamide (PubChem CID 1428250) has the molecular formula C22H28BrN3O3S and a molecular weight of 494.46 g/mol. Its IUPAC name is 4-bromo-N-[2,5-diethoxy-4-(2-methylpropylcarbamothioylamino)phenyl]benzamide.
| Compound Name | 4-bromo-N-[2,5-diethoxy-4-(2-methylpropylcarbamothioylamino)phenyl]benzamide |
|---|---|
| PubChem CID | 1428250 |
| Molecular Formula | C22H28BrN3O3S |
| Molecular Weight | 494.46 g/mol |
| Exact Mass | 493.10 |
| IUPAC Name | 4-bromo-N-[2,5-diethoxy-4-(2-methylpropylcarbamothioylamino)phenyl]benzamide |
| SMILES | CCOc1cc(NC(=S)NCC(C)C)c(OCC)cc1NC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C22H28BrN3O3S/c1-5-28-19-12-18(26-22(30)24-13-14(3)4)20(29-6-2)11-17(19)25-21(27)15-7-9-16(23)10-8-15/h7-12,14H,5-6,13H2,1-4H3,(H,25,27)(H2,24,26,30) |
| InChIKey | GICDHNWBWFQKNY-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.46 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|