C15H16ClN5O2S — CID 43076044
1-(2-chloro-5-nitrophenyl)-3-[[2-(dimethylamino)-3-pyridinyl]methyl]thiourea (PubChem CID 43076044) has the molecular formula C15H16ClN5O2S and a molecular weight of 365.85 g/mol. Its IUPAC name is 1-(2-chloro-5-nitrophenyl)-3-[[2-(dimethylamino)-3-pyridinyl]methyl]thiourea.
| Compound Name | 1-(2-chloro-5-nitrophenyl)-3-[[2-(dimethylamino)-3-pyridinyl]methyl]thiourea |
|---|---|
| PubChem CID | 43076044 |
| Molecular Formula | C15H16ClN5O2S |
| Molecular Weight | 365.85 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | 1-(2-chloro-5-nitrophenyl)-3-[[2-(dimethylamino)-3-pyridinyl]methyl]thiourea |
| SMILES | CN(C)c1ncccc1CNC(=S)Nc1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C15H16ClN5O2S/c1-20(2)14-10(4-3-7-17-14)9-18-15(24)19-13-8-11(21(22)23)5-6-12(13)16/h3-8H,9H2,1-2H3,(H2,18,19,24) |
| InChIKey | WDKFHUGOKPQGAS-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 83.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.85 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|