C18H22N4O2 — CID 124624696
N,N-dimethyl-3-[[[(1S)-7-nitro-1,2,3,4-tetrahydronaphthalen-1-yl]amino]methyl]pyridin-2-amine (PubChem CID 124624696) has the molecular formula C18H22N4O2 and a molecular weight of 326.40 g/mol. Its IUPAC name is N,N-dimethyl-3-[[[(1S)-7-nitro-1,2,3,4-tetrahydronaphthalen-1-yl]amino]methyl]pyridin-2-amine.
| Compound Name | N,N-dimethyl-3-[[[(1S)-7-nitro-1,2,3,4-tetrahydronaphthalen-1-yl]amino]methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 124624696 |
| Molecular Formula | C18H22N4O2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | N,N-dimethyl-3-[[[(1S)-7-nitro-1,2,3,4-tetrahydronaphthalen-1-yl]amino]methyl]pyridin-2-amine |
| SMILES | CN(C)c1ncccc1CN[C@H]1CCCc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C18H22N4O2/c1-21(2)18-14(6-4-10-19-18)12-20-17-7-3-5-13-8-9-15(22(23)24)11-16(13)17/h4,6,8-11,17,20H,3,5,7,12H2,1-2H3/t17-/m0/s1 |
| InChIKey | STFAGFPCQVBMGM-KRWDZBQOSA-N |
| XLogP | 3.22 |
| TPSA | 71.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|