C17H22N2O2S — CID 23607945
1-(2,3-dimethylphenyl)-3-[3-(furan-2-ylmethylsulfanyl)propyl]urea (PubChem CID 23607945) has the molecular formula C17H22N2O2S and a molecular weight of 318.44 g/mol. Its IUPAC name is 1-(2,3-dimethylphenyl)-3-[3-(furan-2-ylmethylsulfanyl)propyl]urea.
| Compound Name | 1-(2,3-dimethylphenyl)-3-[3-(furan-2-ylmethylsulfanyl)propyl]urea |
|---|---|
| PubChem CID | 23607945 |
| Molecular Formula | C17H22N2O2S |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | 1-(2,3-dimethylphenyl)-3-[3-(furan-2-ylmethylsulfanyl)propyl]urea |
| SMILES | Cc1cccc(NC(=O)NCCCSCc2ccco2)c1C |
| InChI | InChI=1S/C17H22N2O2S/c1-13-6-3-8-16(14(13)2)19-17(20)18-9-5-11-22-12-15-7-4-10-21-15/h3-4,6-8,10H,5,9,11-12H2,1-2H3,(H2,18,19,20) |
| InChIKey | CBEOEMFDUMLIPG-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|